5-Methoxy-nicotinic acid
Catalog No: FT-0678833
CAS No: 20826-03-3
- Chemical Name: 5-Methoxy-nicotinic acid
- Molecular Formula: C7H7NO3
- Molecular Weight: 153.14
- InChI Key: VDZUWTLBWRZRTR-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7NO3/c1-11-6-2-5(7(9)10)3-8-4-6/h2-4H,1H3,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 153.13500 |
| Density: | 1.284g/cm3 |
| CAS: | 20826-03-3 |
| Bolling_Point: | 330.9ºC at 760 mmHg |
| Product_Name: | 5-methoxypyridine-3-carboxylic acid |
| Melting_Point: | N/A |
| Flash_Point: | 154ºC |
| MF: | C7H7NO3 |
| Density: | 1.284g/cm3 |
|---|---|
| LogP: | 0.78840 |
| Flash_Point: | 154ºC |
| Refractive_Index: | 1.549 |
| FW: | 153.13500 |
| PSA: | 59.42000 |
| MF: | C7H7NO3 |
| Bolling_Point: | 330.9ºC at 760 mmHg |
| Vapor_Pressure: | 6.43E-05mmHg at 25°C |
| Exact_Mass: | 153.04300 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)